C8HF7O — CID 130136659
2,2-difluoro-1-(2,3,4,5,6-pentafluorophenyl)ethanone (PubChem CID 130136659) has the molecular formula C8HF7O and a molecular weight of 246.08 g/mol. Its IUPAC name is 2,2-difluoro-1-(2,3,4,5,6-pentafluorophenyl)ethanone.
| Compound Name | 2,2-difluoro-1-(2,3,4,5,6-pentafluorophenyl)ethanone |
|---|---|
| PubChem CID | 130136659 |
| Molecular Formula | C8HF7O |
| Molecular Weight | 246.08 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | 2,2-difluoro-1-(2,3,4,5,6-pentafluorophenyl)ethanone |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)C(F)F |
| InChI | InChI=1S/C8HF7O/c9-2-1(7(16)8(14)15)3(10)5(12)6(13)4(2)11/h8H |
| InChIKey | HIPCYTSRVSNSAY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.08 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|