C10H14N2O2 — CID 130137807
4-amino-5-methoxy-1,2,3,4-tetrahydroquinolin-3-ol (PubChem CID 130137807) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-amino-5-methoxy-1,2,3,4-tetrahydroquinolin-3-ol.
| Compound Name | 4-amino-5-methoxy-1,2,3,4-tetrahydroquinolin-3-ol |
|---|---|
| PubChem CID | 130137807 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 4-amino-5-methoxy-1,2,3,4-tetrahydroquinolin-3-ol |
| SMILES | COc1cccc2c1C(N)C(O)CN2 |
| InChI | InChI=1S/C10H14N2O2/c1-14-8-4-2-3-6-9(8)10(11)7(13)5-12-6/h2-4,7,10,12-13H,5,11H2,1H3 |
| InChIKey | PCBPFMXFKLNNET-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |