C17H18N2 — CID 13014393
(4aS,9bR)-5-phenyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole (PubChem CID 13014393) has the molecular formula C17H18N2 and a molecular weight of 250.35 g/mol. Its IUPAC name is (4aS,9bR)-5-phenyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole.
| Compound Name | (4aS,9bR)-5-phenyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 13014393 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | (4aS,9bR)-5-phenyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
| SMILES | c1ccc(N2c3ccccc3[C@@H]3CNCC[C@@H]32)cc1 |
| InChI | InChI=1S/C17H18N2/c1-2-6-13(7-3-1)19-16-9-5-4-8-14(16)15-12-18-11-10-17(15)19/h1-9,15,17-18H,10-12H2/t15-,17-/m0/s1 |
| InChIKey | CJWPRFAPIUPOSX-RDJZCZTQSA-N |
| XLogP | 3.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |