C27H29FN2O — CID 13014402
4-[(4aS,9bR)-5-phenyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]-1-(4-fluorophenyl)butan-1-ol (PubChem CID 13014402) has the molecular formula C27H29FN2O and a molecular weight of 416.54 g/mol. Its IUPAC name is 4-[(4aS,9bR)-5-phenyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]-1-(4-fluorophenyl)butan-1-ol.
| Compound Name | 4-[(4aS,9bR)-5-phenyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]-1-(4-fluorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 13014402 |
| Molecular Formula | C27H29FN2O |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 4-[(4aS,9bR)-5-phenyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-2-yl]-1-(4-fluorophenyl)butan-1-ol |
| SMILES | OC(CCCN1CC[C@H]2[C@@H](C1)c1ccccc1N2c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H29FN2O/c28-21-14-12-20(13-15-21)27(31)11-6-17-29-18-16-26-24(19-29)23-9-4-5-10-25(23)30(26)22-7-2-1-3-8-22/h1-5,7-10,12-15,24,26-27,31H,6,11,16-19H2/t24-,26-,27?/m0/s1 |
| InChIKey | YYTDSKXSYPHJOS-OGUPFJCYSA-N |
| XLogP | 5.65 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |