C9H16N2O2 — CID 130146070
N-[5-(hydroxymethyl)pyrrolidin-3-yl]cyclopropanecarboxamide (PubChem CID 130146070) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is N-[5-(hydroxymethyl)pyrrolidin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-(hydroxymethyl)pyrrolidin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 130146070 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | N-[5-(hydroxymethyl)pyrrolidin-3-yl]cyclopropanecarboxamide |
| SMILES | O=C(NC1CNC(CO)C1)C1CC1 |
| InChI | InChI=1S/C9H16N2O2/c12-5-8-3-7(4-10-8)11-9(13)6-1-2-6/h6-8,10,12H,1-5H2,(H,11,13) |
| InChIKey | UIQUZNDGRIZVDV-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |