About spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-ylmethanol
spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-ylmethanol (PubChem CID 130146735) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-ylmethanol.
Molecular Properties
| Compound Name | spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-ylmethanol |
| PubChem CID | 130146735 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-ylmethanol |
| SMILES | OCC1CC2OC1C=CC21OCCO1 |
| InChI | InChI=1S/C10H14O4/c11-6-7-5-9-10(12-3-4-13-10)2-1-8(7)14-9/h1-2,7-9,11H,3-6H2 |
| InChIKey | DTHYFQITPKKXQF-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-ylmethanol?
The IUPAC name of spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-ylmethanol (CID 130146735) is spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-ylmethanol.
What is the SMILES notation for spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-ylmethanol?
The canonical SMILES for spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-ylmethanol is OCC1CC2OC1C=CC21OCCO1.
What is the InChIKey of spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-ylmethanol?
The InChIKey is DTHYFQITPKKXQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c11-6-7-5-9-10(12-3-4-13-10)2-1-8(7)14-9/h1-2,7-9,11H,3-6H2.
What are the key properties of spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-ylmethanol?
spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-ylmethanol has a molecular weight of 198.22 g/mol, XLogP of 0.07, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dioxolane-2,2'-8-oxabicyclo[3.2.1]oct-3-ene]-6'-ylmethanol is sourced from PubChem (CID 130146735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).