About 2-(5,6-dihydroxy-4-methoxycyclohex-2-en-1-ylidene)acetonitrile
2-(5,6-dihydroxy-4-methoxycyclohex-2-en-1-ylidene)acetonitrile (PubChem CID 130146776) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-(5,6-dihydroxy-4-methoxycyclohex-2-en-1-ylidene)acetonitrile.
Molecular Properties
| Compound Name | 2-(5,6-dihydroxy-4-methoxycyclohex-2-en-1-ylidene)acetonitrile |
| PubChem CID | 130146776 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-(5,6-dihydroxy-4-methoxycyclohex-2-en-1-ylidene)acetonitrile |
| SMILES | COC1C=CC(=CC#N)C(O)C1O |
| InChI | InChI=1S/C9H11NO3/c1-13-7-3-2-6(4-5-10)8(11)9(7)12/h2-4,7-9,11-12H,1H3 |
| InChIKey | AJGRBKZAZQRHGQ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,6-dihydroxy-4-methoxycyclohex-2-en-1-ylidene)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,6-dihydroxy-4-methoxycyclohex-2-en-1-ylidene)acetonitrile?
The IUPAC name of 2-(5,6-dihydroxy-4-methoxycyclohex-2-en-1-ylidene)acetonitrile (CID 130146776) is 2-(5,6-dihydroxy-4-methoxycyclohex-2-en-1-ylidene)acetonitrile.
What is the SMILES notation for 2-(5,6-dihydroxy-4-methoxycyclohex-2-en-1-ylidene)acetonitrile?
The canonical SMILES for 2-(5,6-dihydroxy-4-methoxycyclohex-2-en-1-ylidene)acetonitrile is COC1C=CC(=CC#N)C(O)C1O.
What is the InChIKey of 2-(5,6-dihydroxy-4-methoxycyclohex-2-en-1-ylidene)acetonitrile?
The InChIKey is AJGRBKZAZQRHGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-13-7-3-2-6(4-5-10)8(11)9(7)12/h2-4,7-9,11-12H,1H3.
What are the key properties of 2-(5,6-dihydroxy-4-methoxycyclohex-2-en-1-ylidene)acetonitrile?
2-(5,6-dihydroxy-4-methoxycyclohex-2-en-1-ylidene)acetonitrile has a molecular weight of 181.19 g/mol, XLogP of -0.26, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dihydroxy-4-methoxycyclohex-2-en-1-ylidene)acetonitrile is sourced from PubChem (CID 130146776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).