About 5-hydroxy-1-azatricyclo[6.3.1.04,12]dodecan-2-one
5-hydroxy-1-azatricyclo[6.3.1.04,12]dodecan-2-one (PubChem CID 130147737) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 5-hydroxy-1-azatricyclo[6.3.1.04,12]dodecan-2-one.
Molecular Properties
| Compound Name | 5-hydroxy-1-azatricyclo[6.3.1.04,12]dodecan-2-one |
| PubChem CID | 130147737 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 5-hydroxy-1-azatricyclo[6.3.1.04,12]dodecan-2-one |
| SMILES | O=C1CC2C(O)CCC3CCCN1C32 |
| InChI | InChI=1S/C11H17NO2/c13-9-4-3-7-2-1-5-12-10(14)6-8(9)11(7)12/h7-9,11,13H,1-6H2 |
| InChIKey | MLQWRVDCABUZSZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-hydroxy-1-azatricyclo[6.3.1.04,12]dodecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-1-azatricyclo[6.3.1.04,12]dodecan-2-one?
The IUPAC name of 5-hydroxy-1-azatricyclo[6.3.1.04,12]dodecan-2-one (CID 130147737) is 5-hydroxy-1-azatricyclo[6.3.1.04,12]dodecan-2-one.
What is the SMILES notation for 5-hydroxy-1-azatricyclo[6.3.1.04,12]dodecan-2-one?
The canonical SMILES for 5-hydroxy-1-azatricyclo[6.3.1.04,12]dodecan-2-one is O=C1CC2C(O)CCC3CCCN1C32.
What is the InChIKey of 5-hydroxy-1-azatricyclo[6.3.1.04,12]dodecan-2-one?
The InChIKey is MLQWRVDCABUZSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c13-9-4-3-7-2-1-5-12-10(14)6-8(9)11(7)12/h7-9,11,13H,1-6H2.
What are the key properties of 5-hydroxy-1-azatricyclo[6.3.1.04,12]dodecan-2-one?
5-hydroxy-1-azatricyclo[6.3.1.04,12]dodecan-2-one has a molecular weight of 195.26 g/mol, XLogP of 0.77, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-1-azatricyclo[6.3.1.04,12]dodecan-2-one is sourced from PubChem (CID 130147737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).