About 3-chlorobenzonitrile
3-chlorobenzonitrile (PubChem CID 13015) has the molecular formula C7H4ClN
and a molecular weight of 137.57 g/mol. Its IUPAC name is 3-chlorobenzonitrile.
Molecular Properties
| Compound Name | 3-chlorobenzonitrile |
| PubChem CID | 13015 |
| Molecular Formula | C7H4ClN |
| Molecular Weight | 137.57 g/mol |
| Exact Mass | 137.00 |
| IUPAC Name | 3-chlorobenzonitrile |
| SMILES | N#Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C7H4ClN/c8-7-3-1-2-6(4-7)5-9/h1-4H |
| InChIKey | WBUOVKBZJOIOAE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.57 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chlorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobenzonitrile?
The IUPAC name of 3-chlorobenzonitrile (CID 13015) is 3-chlorobenzonitrile.
What is the SMILES notation for 3-chlorobenzonitrile?
The canonical SMILES for 3-chlorobenzonitrile is N#Cc1cccc(Cl)c1.
What is the InChIKey of 3-chlorobenzonitrile?
The InChIKey is WBUOVKBZJOIOAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClN/c8-7-3-1-2-6(4-7)5-9/h1-4H.
What are the key properties of 3-chlorobenzonitrile?
3-chlorobenzonitrile has a molecular weight of 137.57 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobenzonitrile is sourced from PubChem (CID 13015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).