About 1-(5-methyl-1,3,4-oxadiazol-2-yl)but-3-en-1-amine
1-(5-methyl-1,3,4-oxadiazol-2-yl)but-3-en-1-amine (PubChem CID 130150283) has the molecular formula C7H11N3O
and a molecular weight of 153.18 g/mol. Its IUPAC name is 1-(5-methyl-1,3,4-oxadiazol-2-yl)but-3-en-1-amine.
Molecular Properties
| Compound Name | 1-(5-methyl-1,3,4-oxadiazol-2-yl)but-3-en-1-amine |
| PubChem CID | 130150283 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 1-(5-methyl-1,3,4-oxadiazol-2-yl)but-3-en-1-amine |
| SMILES | C=CCC(N)c1nnc(C)o1 |
| InChI | InChI=1S/C7H11N3O/c1-3-4-6(8)7-10-9-5(2)11-7/h3,6H,1,4,8H2,2H3 |
| InChIKey | OIYQQTNPAXXSMT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-methyl-1,3,4-oxadiazol-2-yl)but-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methyl-1,3,4-oxadiazol-2-yl)but-3-en-1-amine?
The IUPAC name of 1-(5-methyl-1,3,4-oxadiazol-2-yl)but-3-en-1-amine (CID 130150283) is 1-(5-methyl-1,3,4-oxadiazol-2-yl)but-3-en-1-amine.
What is the SMILES notation for 1-(5-methyl-1,3,4-oxadiazol-2-yl)but-3-en-1-amine?
The canonical SMILES for 1-(5-methyl-1,3,4-oxadiazol-2-yl)but-3-en-1-amine is C=CCC(N)c1nnc(C)o1.
What is the InChIKey of 1-(5-methyl-1,3,4-oxadiazol-2-yl)but-3-en-1-amine?
The InChIKey is OIYQQTNPAXXSMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O/c1-3-4-6(8)7-10-9-5(2)11-7/h3,6H,1,4,8H2,2H3.
What are the key properties of 1-(5-methyl-1,3,4-oxadiazol-2-yl)but-3-en-1-amine?
1-(5-methyl-1,3,4-oxadiazol-2-yl)but-3-en-1-amine has a molecular weight of 153.18 g/mol, XLogP of 0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methyl-1,3,4-oxadiazol-2-yl)but-3-en-1-amine is sourced from PubChem (CID 130150283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).