About 2-hydroxy-4-methyl-2,3,4,6,7,8-hexahydrochromen-5-one
2-hydroxy-4-methyl-2,3,4,6,7,8-hexahydrochromen-5-one (PubChem CID 130150914) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-hydroxy-4-methyl-2,3,4,6,7,8-hexahydrochromen-5-one.
Analyze 2-hydroxy-4-methyl-2,3,4,6,7,8-hexahydrochromen-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-4-methyl-2,3,4,6,7,8-hexahydrochromen-5-one?
The IUPAC name of 2-hydroxy-4-methyl-2,3,4,6,7,8-hexahydrochromen-5-one (CID 130150914) is 2-hydroxy-4-methyl-2,3,4,6,7,8-hexahydrochromen-5-one.
What is the SMILES notation for 2-hydroxy-4-methyl-2,3,4,6,7,8-hexahydrochromen-5-one?
The canonical SMILES for 2-hydroxy-4-methyl-2,3,4,6,7,8-hexahydrochromen-5-one is CC1CC(O)OC2=C1C(=O)CCC2.
What is the InChIKey of 2-hydroxy-4-methyl-2,3,4,6,7,8-hexahydrochromen-5-one?
The InChIKey is OFNZWEPOAMVIEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-6-5-9(12)13-8-4-2-3-7(11)10(6)8/h6,9,12H,2-5H2,1H3.
What are the key properties of 2-hydroxy-4-methyl-2,3,4,6,7,8-hexahydrochromen-5-one?
2-hydroxy-4-methyl-2,3,4,6,7,8-hexahydrochromen-5-one has a molecular weight of 182.22 g/mol, XLogP of 1.37, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4-methyl-2,3,4,6,7,8-hexahydrochromen-5-one is sourced from PubChem (CID 130150914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).