About tetracyclo[5.4.0.02,11.03,6]undeca-4,9-dien-8-ol
tetracyclo[5.4.0.02,11.03,6]undeca-4,9-dien-8-ol (PubChem CID 130151122) has the molecular formula C11H12O
and a molecular weight of 160.22 g/mol. Its IUPAC name is tetracyclo[5.4.0.02,11.03,6]undeca-4,9-dien-8-ol.
Molecular Properties
| Compound Name | tetracyclo[5.4.0.02,11.03,6]undeca-4,9-dien-8-ol |
| PubChem CID | 130151122 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | tetracyclo[5.4.0.02,11.03,6]undeca-4,9-dien-8-ol |
| SMILES | OC1C=CC2C3C4C=CC4C1C23 |
| InChI | InChI=1S/C11H12O/c12-8-4-3-7-9-5-1-2-6(5)10(8)11(7)9/h1-12H |
| InChIKey | KJJPPDUHDUQMHA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tetracyclo[5.4.0.02,11.03,6]undeca-4,9-dien-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracyclo[5.4.0.02,11.03,6]undeca-4,9-dien-8-ol?
The IUPAC name of tetracyclo[5.4.0.02,11.03,6]undeca-4,9-dien-8-ol (CID 130151122) is tetracyclo[5.4.0.02,11.03,6]undeca-4,9-dien-8-ol.
What is the SMILES notation for tetracyclo[5.4.0.02,11.03,6]undeca-4,9-dien-8-ol?
The canonical SMILES for tetracyclo[5.4.0.02,11.03,6]undeca-4,9-dien-8-ol is OC1C=CC2C3C4C=CC4C1C23.
What is the InChIKey of tetracyclo[5.4.0.02,11.03,6]undeca-4,9-dien-8-ol?
The InChIKey is KJJPPDUHDUQMHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O/c12-8-4-3-7-9-5-1-2-6(5)10(8)11(7)9/h1-12H.
What are the key properties of tetracyclo[5.4.0.02,11.03,6]undeca-4,9-dien-8-ol?
tetracyclo[5.4.0.02,11.03,6]undeca-4,9-dien-8-ol has a molecular weight of 160.22 g/mol, XLogP of 1.21, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetracyclo[5.4.0.02,11.03,6]undeca-4,9-dien-8-ol is sourced from PubChem (CID 130151122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).