About N,N-bis(2-fluoro-2,2-dinitroethyl)carbamoyl chloride
N,N-bis(2-fluoro-2,2-dinitroethyl)carbamoyl chloride (PubChem CID 13015161) has the molecular formula C5H4ClF2N5O9
and a molecular weight of 351.56 g/mol. Its IUPAC name is N,N-bis(2-fluoro-2,2-dinitroethyl)carbamoyl chloride.
Molecular Properties
| Compound Name | N,N-bis(2-fluoro-2,2-dinitroethyl)carbamoyl chloride |
| PubChem CID | 13015161 |
| Molecular Formula | C5H4ClF2N5O9 |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | N,N-bis(2-fluoro-2,2-dinitroethyl)carbamoyl chloride |
| SMILES | O=C(Cl)N(CC(F)([N+](=O)[O-])[N+](=O)[O-])CC(F)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C5H4ClF2N5O9/c6-3(14)9(1-4(7,10(15)16)11(17)18)2-5(8,12(19)20)13(21)22/h1-2H2 |
| InChIKey | LXGQTVQHSFAJEV-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 192.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis(2-fluoro-2,2-dinitroethyl)carbamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(2-fluoro-2,2-dinitroethyl)carbamoyl chloride?
The IUPAC name of N,N-bis(2-fluoro-2,2-dinitroethyl)carbamoyl chloride (CID 13015161) is N,N-bis(2-fluoro-2,2-dinitroethyl)carbamoyl chloride.
What is the SMILES notation for N,N-bis(2-fluoro-2,2-dinitroethyl)carbamoyl chloride?
The canonical SMILES for N,N-bis(2-fluoro-2,2-dinitroethyl)carbamoyl chloride is O=C(Cl)N(CC(F)([N+](=O)[O-])[N+](=O)[O-])CC(F)([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of N,N-bis(2-fluoro-2,2-dinitroethyl)carbamoyl chloride?
The InChIKey is LXGQTVQHSFAJEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4ClF2N5O9/c6-3(14)9(1-4(7,10(15)16)11(17)18)2-5(8,12(19)20)13(21)22/h1-2H2.
What are the key properties of N,N-bis(2-fluoro-2,2-dinitroethyl)carbamoyl chloride?
N,N-bis(2-fluoro-2,2-dinitroethyl)carbamoyl chloride has a molecular weight of 351.56 g/mol, XLogP of 0.00, 8 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(2-fluoro-2,2-dinitroethyl)carbamoyl chloride is sourced from PubChem (CID 13015161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).