About 1-amino-1-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-2-ol
1-amino-1-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-2-ol (PubChem CID 130151693) has the molecular formula C7H13N3O2
and a molecular weight of 171.20 g/mol. Its IUPAC name is 1-amino-1-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-amino-1-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-2-ol |
| PubChem CID | 130151693 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 1-amino-1-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-2-ol |
| SMILES | CCc1nnc(C(N)C(C)O)o1 |
| InChI | InChI=1S/C7H13N3O2/c1-3-5-9-10-7(12-5)6(8)4(2)11/h4,6,11H,3,8H2,1-2H3 |
| InChIKey | LGYUZLVAIGFWJJ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-amino-1-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-1-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-2-ol?
The IUPAC name of 1-amino-1-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-2-ol (CID 130151693) is 1-amino-1-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-2-ol.
What is the SMILES notation for 1-amino-1-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-2-ol?
The canonical SMILES for 1-amino-1-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-2-ol is CCc1nnc(C(N)C(C)O)o1.
What is the InChIKey of 1-amino-1-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-2-ol?
The InChIKey is LGYUZLVAIGFWJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2/c1-3-5-9-10-7(12-5)6(8)4(2)11/h4,6,11H,3,8H2,1-2H3.
What are the key properties of 1-amino-1-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-2-ol?
1-amino-1-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-2-ol has a molecular weight of 171.20 g/mol, XLogP of 0.01, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-1-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-2-ol is sourced from PubChem (CID 130151693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).