About 1-(2,5-dihydroxy-3,4-dimethylcyclohex-3-en-1-yl)ethanone
1-(2,5-dihydroxy-3,4-dimethylcyclohex-3-en-1-yl)ethanone (PubChem CID 130152237) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is 1-(2,5-dihydroxy-3,4-dimethylcyclohex-3-en-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2,5-dihydroxy-3,4-dimethylcyclohex-3-en-1-yl)ethanone |
| PubChem CID | 130152237 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 1-(2,5-dihydroxy-3,4-dimethylcyclohex-3-en-1-yl)ethanone |
| SMILES | CC(=O)C1CC(O)C(C)=C(C)C1O |
| InChI | InChI=1S/C10H16O3/c1-5-6(2)10(13)8(7(3)11)4-9(5)12/h8-10,12-13H,4H2,1-3H3 |
| InChIKey | KJYQNKVHQRRQNP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,5-dihydroxy-3,4-dimethylcyclohex-3-en-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dihydroxy-3,4-dimethylcyclohex-3-en-1-yl)ethanone?
The IUPAC name of 1-(2,5-dihydroxy-3,4-dimethylcyclohex-3-en-1-yl)ethanone (CID 130152237) is 1-(2,5-dihydroxy-3,4-dimethylcyclohex-3-en-1-yl)ethanone.
What is the SMILES notation for 1-(2,5-dihydroxy-3,4-dimethylcyclohex-3-en-1-yl)ethanone?
The canonical SMILES for 1-(2,5-dihydroxy-3,4-dimethylcyclohex-3-en-1-yl)ethanone is CC(=O)C1CC(O)C(C)=C(C)C1O.
What is the InChIKey of 1-(2,5-dihydroxy-3,4-dimethylcyclohex-3-en-1-yl)ethanone?
The InChIKey is KJYQNKVHQRRQNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-5-6(2)10(13)8(7(3)11)4-9(5)12/h8-10,12-13H,4H2,1-3H3.
What are the key properties of 1-(2,5-dihydroxy-3,4-dimethylcyclohex-3-en-1-yl)ethanone?
1-(2,5-dihydroxy-3,4-dimethylcyclohex-3-en-1-yl)ethanone has a molecular weight of 184.23 g/mol, XLogP of 0.65, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dihydroxy-3,4-dimethylcyclohex-3-en-1-yl)ethanone is sourced from PubChem (CID 130152237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).