C8H4Cl3IO — CID 130153516
2-chloro-1-(2,6-dichloro-4-iodophenyl)ethanone (PubChem CID 130153516) has the molecular formula C8H4Cl3IO and a molecular weight of 349.38 g/mol. Its IUPAC name is 2-chloro-1-(2,6-dichloro-4-iodophenyl)ethanone.
| Compound Name | 2-chloro-1-(2,6-dichloro-4-iodophenyl)ethanone |
|---|---|
| PubChem CID | 130153516 |
| Molecular Formula | C8H4Cl3IO |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 347.84 |
| IUPAC Name | 2-chloro-1-(2,6-dichloro-4-iodophenyl)ethanone |
| SMILES | O=C(CCl)c1c(Cl)cc(I)cc1Cl |
| InChI | InChI=1S/C8H4Cl3IO/c9-3-7(13)8-5(10)1-4(12)2-6(8)11/h1-2H,3H2 |
| InChIKey | OSPMZOLBFBTBHV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|