About 2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanol
2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanol (PubChem CID 13015381) has the molecular formula C19H19NO3S
and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanol |
| PubChem CID | 13015381 |
| Molecular Formula | C19H19NO3S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanol |
| SMILES | COc1ccc(-c2nc(CCO)sc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H19NO3S/c1-22-15-7-3-13(4-8-15)18-19(24-17(20-18)11-12-21)14-5-9-16(23-2)10-6-14/h3-10,21H,11-12H2,1-2H3 |
| InChIKey | HXXXONYRSIPELC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanol?
The IUPAC name of 2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanol (CID 13015381) is 2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanol.
What is the SMILES notation for 2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanol?
The canonical SMILES for 2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanol is COc1ccc(-c2nc(CCO)sc2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanol?
The InChIKey is HXXXONYRSIPELC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO3S/c1-22-15-7-3-13(4-8-15)18-19(24-17(20-18)11-12-21)14-5-9-16(23-2)10-6-14/h3-10,21H,11-12H2,1-2H3.
What are the key properties of 2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanol?
2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanol has a molecular weight of 341.43 g/mol, XLogP of 4.03, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanol is sourced from PubChem (CID 13015381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).