About 4,5-bis(4-chlorophenyl)-2-(trifluoromethyl)-1,3-thiazole
4,5-bis(4-chlorophenyl)-2-(trifluoromethyl)-1,3-thiazole (PubChem CID 13015387) has the molecular formula C16H8Cl2F3NS
and a molecular weight of 374.21 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-2-(trifluoromethyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4,5-bis(4-chlorophenyl)-2-(trifluoromethyl)-1,3-thiazole |
| PubChem CID | 13015387 |
| Molecular Formula | C16H8Cl2F3NS |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-2-(trifluoromethyl)-1,3-thiazole |
| SMILES | FC(F)(F)c1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C16H8Cl2F3NS/c17-11-5-1-9(2-6-11)13-14(10-3-7-12(18)8-4-10)23-15(22-13)16(19,20)21/h1-8H |
| InChIKey | QJRGQWNURIDPSL-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-bis(4-chlorophenyl)-2-(trifluoromethyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(4-chlorophenyl)-2-(trifluoromethyl)-1,3-thiazole?
The IUPAC name of 4,5-bis(4-chlorophenyl)-2-(trifluoromethyl)-1,3-thiazole (CID 13015387) is 4,5-bis(4-chlorophenyl)-2-(trifluoromethyl)-1,3-thiazole.
What is the SMILES notation for 4,5-bis(4-chlorophenyl)-2-(trifluoromethyl)-1,3-thiazole?
The canonical SMILES for 4,5-bis(4-chlorophenyl)-2-(trifluoromethyl)-1,3-thiazole is FC(F)(F)c1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)s1.
What is the InChIKey of 4,5-bis(4-chlorophenyl)-2-(trifluoromethyl)-1,3-thiazole?
The InChIKey is QJRGQWNURIDPSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8Cl2F3NS/c17-11-5-1-9(2-6-11)13-14(10-3-7-12(18)8-4-10)23-15(22-13)16(19,20)21/h1-8H.
What are the key properties of 4,5-bis(4-chlorophenyl)-2-(trifluoromethyl)-1,3-thiazole?
4,5-bis(4-chlorophenyl)-2-(trifluoromethyl)-1,3-thiazole has a molecular weight of 374.21 g/mol, XLogP of 6.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(4-chlorophenyl)-2-(trifluoromethyl)-1,3-thiazole is sourced from PubChem (CID 13015387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).