About 2,2-dimethyl-N'-phenyl-N,N-di(propan-2-yl)propanimidamide
2,2-dimethyl-N'-phenyl-N,N-di(propan-2-yl)propanimidamide (PubChem CID 13015490) has the molecular formula C17H28N2
and a molecular weight of 260.42 g/mol. Its IUPAC name is 2,2-dimethyl-N'-phenyl-N,N-di(propan-2-yl)propanimidamide.
Molecular Properties
| Compound Name | 2,2-dimethyl-N'-phenyl-N,N-di(propan-2-yl)propanimidamide |
| PubChem CID | 13015490 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 2,2-dimethyl-N'-phenyl-N,N-di(propan-2-yl)propanimidamide |
| SMILES | CC(C)N(/C(=N/c1ccccc1)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C17H28N2/c1-13(2)19(14(3)4)16(17(5,6)7)18-15-11-9-8-10-12-15/h8-14H,1-7H3/b18-16+ |
| InChIKey | GFMVACFFLFQILW-FBMGVBCBSA-N |
| XLogP | 4.88 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-N'-phenyl-N,N-di(propan-2-yl)propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-N'-phenyl-N,N-di(propan-2-yl)propanimidamide?
The IUPAC name of 2,2-dimethyl-N'-phenyl-N,N-di(propan-2-yl)propanimidamide (CID 13015490) is 2,2-dimethyl-N'-phenyl-N,N-di(propan-2-yl)propanimidamide.
What is the SMILES notation for 2,2-dimethyl-N'-phenyl-N,N-di(propan-2-yl)propanimidamide?
The canonical SMILES for 2,2-dimethyl-N'-phenyl-N,N-di(propan-2-yl)propanimidamide is CC(C)N(/C(=N/c1ccccc1)C(C)(C)C)C(C)C.
What is the InChIKey of 2,2-dimethyl-N'-phenyl-N,N-di(propan-2-yl)propanimidamide?
The InChIKey is GFMVACFFLFQILW-FBMGVBCBSA-N. The full InChI is InChI=1S/C17H28N2/c1-13(2)19(14(3)4)16(17(5,6)7)18-15-11-9-8-10-12-15/h8-14H,1-7H3/b18-16+.
What are the key properties of 2,2-dimethyl-N'-phenyl-N,N-di(propan-2-yl)propanimidamide?
2,2-dimethyl-N'-phenyl-N,N-di(propan-2-yl)propanimidamide has a molecular weight of 260.42 g/mol, XLogP of 4.88, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-N'-phenyl-N,N-di(propan-2-yl)propanimidamide is sourced from PubChem (CID 13015490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).