C7H9ClN2O2S — CID 130155054
2-chloro-5-methylsulfonylbenzene-1,3-diamine (PubChem CID 130155054) has the molecular formula C7H9ClN2O2S and a molecular weight of 220.68 g/mol. Its IUPAC name is 2-chloro-5-methylsulfonylbenzene-1,3-diamine.
| Compound Name | 2-chloro-5-methylsulfonylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 130155054 |
| Molecular Formula | C7H9ClN2O2S |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 2-chloro-5-methylsulfonylbenzene-1,3-diamine |
| SMILES | CS(=O)(=O)c1cc(N)c(Cl)c(N)c1 |
| InChI | InChI=1S/C7H9ClN2O2S/c1-13(11,12)4-2-5(9)7(8)6(10)3-4/h2-3H,9-10H2,1H3 |
| InChIKey | JNXAMXUKLJUHJF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|