About [1,2,4]thiadiazolo[2,3-a]pyrimidin-8-ium-2-amine
[1,2,4]thiadiazolo[2,3-a]pyrimidin-8-ium-2-amine (PubChem CID 130155543) has the molecular formula C5H5N4S+
and a molecular weight of 153.19 g/mol. Its IUPAC name is [1,2,4]thiadiazolo[2,3-a]pyrimidin-8-ium-2-amine.
Molecular Properties
| Compound Name | [1,2,4]thiadiazolo[2,3-a]pyrimidin-8-ium-2-amine |
| PubChem CID | 130155543 |
| Molecular Formula | C5H5N4S+ |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.02 |
| IUPAC Name | [1,2,4]thiadiazolo[2,3-a]pyrimidin-8-ium-2-amine |
| SMILES | Nc1nc2nccc[n+]2s1 |
| InChI | InChI=1S/C5H4N4S/c6-4-8-5-7-2-1-3-9(5)10-4/h1-3,6H/p+1 |
| InChIKey | DRPYLXPMIOQYTN-UHFFFAOYSA-O |
| XLogP | -0.14 |
| TPSA | 55.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [1,2,4]thiadiazolo[2,3-a]pyrimidin-8-ium-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2,4]thiadiazolo[2,3-a]pyrimidin-8-ium-2-amine?
The IUPAC name of [1,2,4]thiadiazolo[2,3-a]pyrimidin-8-ium-2-amine (CID 130155543) is [1,2,4]thiadiazolo[2,3-a]pyrimidin-8-ium-2-amine.
What is the SMILES notation for [1,2,4]thiadiazolo[2,3-a]pyrimidin-8-ium-2-amine?
The canonical SMILES for [1,2,4]thiadiazolo[2,3-a]pyrimidin-8-ium-2-amine is Nc1nc2nccc[n+]2s1.
What is the InChIKey of [1,2,4]thiadiazolo[2,3-a]pyrimidin-8-ium-2-amine?
The InChIKey is DRPYLXPMIOQYTN-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H4N4S/c6-4-8-5-7-2-1-3-9(5)10-4/h1-3,6H/p+1.
What are the key properties of [1,2,4]thiadiazolo[2,3-a]pyrimidin-8-ium-2-amine?
[1,2,4]thiadiazolo[2,3-a]pyrimidin-8-ium-2-amine has a molecular weight of 153.19 g/mol, XLogP of -0.14, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2,4]thiadiazolo[2,3-a]pyrimidin-8-ium-2-amine is sourced from PubChem (CID 130155543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).