C13H23NO2 — CID 130156383
spiro[1,2,3,4,5,7,8,8a-octahydronaphthalene-6,2'-1,3-dioxolane]-4a-ylmethanamine (PubChem CID 130156383) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is spiro[1,2,3,4,5,7,8,8a-octahydronaphthalene-6,2'-1,3-dioxolane]-4a-ylmethanamine.
| Compound Name | spiro[1,2,3,4,5,7,8,8a-octahydronaphthalene-6,2'-1,3-dioxolane]-4a-ylmethanamine |
|---|---|
| PubChem CID | 130156383 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | spiro[1,2,3,4,5,7,8,8a-octahydronaphthalene-6,2'-1,3-dioxolane]-4a-ylmethanamine |
| SMILES | NCC12CCCCC1CCC1(C2)OCCO1 |
| InChI | InChI=1S/C13H23NO2/c14-10-12-5-2-1-3-11(12)4-6-13(9-12)15-7-8-16-13/h11H,1-10,14H2 |
| InChIKey | MBRUFNNJKFYFDB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |