C18H20N2S — CID 13015681
N,N-dimethyl-1-(8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaen-15-yl)methanamine (PubChem CID 13015681) has the molecular formula C18H20N2S and a molecular weight of 296.44 g/mol. Its IUPAC name is N,N-dimethyl-1-(8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaen-15-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaen-15-yl)methanamine |
|---|---|
| PubChem CID | 13015681 |
| Molecular Formula | C18H20N2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N,N-dimethyl-1-(8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaen-15-yl)methanamine |
| SMILES | CN(C)CC1Cc2cccc3c2N(C1)c1ccccc1S3 |
| InChI | InChI=1S/C18H20N2S/c1-19(2)11-13-10-14-6-5-9-17-18(14)20(12-13)15-7-3-4-8-16(15)21-17/h3-9,13H,10-12H2,1-2H3 |
| InChIKey | FISKMTGUXLEBAZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |