About methyl 2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate
methyl 2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate (PubChem CID 13016052) has the molecular formula C10H10O6
and a molecular weight of 226.18 g/mol. Its IUPAC name is methyl 2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate |
| PubChem CID | 13016052 |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | methyl 2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(OC)C(=O)C=C(OC)C1=O |
| InChI | InChI=1S/C10H10O6/c1-14-6-4-5(11)9(15-2)7(8(6)12)10(13)16-3/h4H,1-3H3 |
| InChIKey | PFVZUJNJVOZOQM-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl 2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate?
The IUPAC name of methyl 2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate (CID 13016052) is methyl 2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate.
What is the SMILES notation for methyl 2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate?
The canonical SMILES for methyl 2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate is COC(=O)C1=C(OC)C(=O)C=C(OC)C1=O.
What is the InChIKey of methyl 2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate?
The InChIKey is PFVZUJNJVOZOQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O6/c1-14-6-4-5(11)9(15-2)7(8(6)12)10(13)16-3/h4H,1-3H3.
What are the key properties of methyl 2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate?
methyl 2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate has a molecular weight of 226.18 g/mol, XLogP of -0.26, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate is sourced from PubChem (CID 13016052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).