C9H11N3O2 — CID 130162707
3-[(5-oxopyrrolidin-2-yl)methyl]pyrimidin-4-one (PubChem CID 130162707) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 3-[(5-oxopyrrolidin-2-yl)methyl]pyrimidin-4-one.
| Compound Name | 3-[(5-oxopyrrolidin-2-yl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 130162707 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-[(5-oxopyrrolidin-2-yl)methyl]pyrimidin-4-one |
| SMILES | O=C1CCC(Cn2cnccc2=O)N1 |
| InChI | InChI=1S/C9H11N3O2/c13-8-2-1-7(11-8)5-12-6-10-4-3-9(12)14/h3-4,6-7H,1-2,5H2,(H,11,13) |
| InChIKey | LWEMDYODZODBHC-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |