About 2-ethenyl-2-methyl-1,3-dithiane
2-ethenyl-2-methyl-1,3-dithiane (PubChem CID 13016307) has the molecular formula C7H12S2
and a molecular weight of 160.31 g/mol. Its IUPAC name is 2-ethenyl-2-methyl-1,3-dithiane.
Molecular Properties
| Compound Name | 2-ethenyl-2-methyl-1,3-dithiane |
| PubChem CID | 13016307 |
| Molecular Formula | C7H12S2 |
| Molecular Weight | 160.31 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | 2-ethenyl-2-methyl-1,3-dithiane |
| SMILES | C=CC1(C)SCCCS1 |
| InChI | InChI=1S/C7H12S2/c1-3-7(2)8-5-4-6-9-7/h3H,1,4-6H2,2H3 |
| InChIKey | AOEMMZBMXHKRIM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-2-methyl-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-2-methyl-1,3-dithiane?
The IUPAC name of 2-ethenyl-2-methyl-1,3-dithiane (CID 13016307) is 2-ethenyl-2-methyl-1,3-dithiane.
What is the SMILES notation for 2-ethenyl-2-methyl-1,3-dithiane?
The canonical SMILES for 2-ethenyl-2-methyl-1,3-dithiane is C=CC1(C)SCCCS1.
What is the InChIKey of 2-ethenyl-2-methyl-1,3-dithiane?
The InChIKey is AOEMMZBMXHKRIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12S2/c1-3-7(2)8-5-4-6-9-7/h3H,1,4-6H2,2H3.
What are the key properties of 2-ethenyl-2-methyl-1,3-dithiane?
2-ethenyl-2-methyl-1,3-dithiane has a molecular weight of 160.31 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-2-methyl-1,3-dithiane is sourced from PubChem (CID 13016307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).