About 1-methyl-4-(1,3-thiazol-5-ylmethylamino)pyrrolidin-2-one
1-methyl-4-(1,3-thiazol-5-ylmethylamino)pyrrolidin-2-one (PubChem CID 130163196) has the molecular formula C9H13N3OS
and a molecular weight of 211.29 g/mol. Its IUPAC name is 1-methyl-4-(1,3-thiazol-5-ylmethylamino)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-methyl-4-(1,3-thiazol-5-ylmethylamino)pyrrolidin-2-one |
| PubChem CID | 130163196 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-methyl-4-(1,3-thiazol-5-ylmethylamino)pyrrolidin-2-one |
| SMILES | CN1CC(NCc2cncs2)CC1=O |
| InChI | InChI=1S/C9H13N3OS/c1-12-5-7(2-9(12)13)11-4-8-3-10-6-14-8/h3,6-7,11H,2,4-5H2,1H3 |
| InChIKey | WINUGWGLNLHNGK-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-4-(1,3-thiazol-5-ylmethylamino)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-(1,3-thiazol-5-ylmethylamino)pyrrolidin-2-one?
The IUPAC name of 1-methyl-4-(1,3-thiazol-5-ylmethylamino)pyrrolidin-2-one (CID 130163196) is 1-methyl-4-(1,3-thiazol-5-ylmethylamino)pyrrolidin-2-one.
What is the SMILES notation for 1-methyl-4-(1,3-thiazol-5-ylmethylamino)pyrrolidin-2-one?
The canonical SMILES for 1-methyl-4-(1,3-thiazol-5-ylmethylamino)pyrrolidin-2-one is CN1CC(NCc2cncs2)CC1=O.
What is the InChIKey of 1-methyl-4-(1,3-thiazol-5-ylmethylamino)pyrrolidin-2-one?
The InChIKey is WINUGWGLNLHNGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3OS/c1-12-5-7(2-9(12)13)11-4-8-3-10-6-14-8/h3,6-7,11H,2,4-5H2,1H3.
What are the key properties of 1-methyl-4-(1,3-thiazol-5-ylmethylamino)pyrrolidin-2-one?
1-methyl-4-(1,3-thiazol-5-ylmethylamino)pyrrolidin-2-one has a molecular weight of 211.29 g/mol, XLogP of 0.46, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-(1,3-thiazol-5-ylmethylamino)pyrrolidin-2-one is sourced from PubChem (CID 130163196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).