C11H12FNO — CID 130163592
azetidin-1-yl-(4-fluoro-2-methylphenyl)methanone (PubChem CID 130163592) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is azetidin-1-yl-(4-fluoro-2-methylphenyl)methanone.
| Compound Name | azetidin-1-yl-(4-fluoro-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 130163592 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | azetidin-1-yl-(4-fluoro-2-methylphenyl)methanone |
| SMILES | Cc1cc(F)ccc1C(=O)N1CCC1 |
| InChI | InChI=1S/C11H12FNO/c1-8-7-9(12)3-4-10(8)11(14)13-5-2-6-13/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | DTZOKFSENLOACX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |