About benzyl 2-oxo-4-phenyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate
benzyl 2-oxo-4-phenyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 13016612) has the molecular formula C21H22N2O4
and a molecular weight of 366.42 g/mol. Its IUPAC name is benzyl 2-oxo-4-phenyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate.
Molecular Properties
| Compound Name | benzyl 2-oxo-4-phenyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate |
| PubChem CID | 13016612 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | benzyl 2-oxo-4-phenyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | O=C1NC(c2ccccc2)C2(CCN(C(=O)OCc3ccccc3)CC2)O1 |
| InChI | InChI=1S/C21H22N2O4/c24-19-22-18(17-9-5-2-6-10-17)21(27-19)11-13-23(14-12-21)20(25)26-15-16-7-3-1-4-8-16/h1-10,18H,11-15H2,(H,22,24) |
| InChIKey | UOAQXHBWPDSWMV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl 2-oxo-4-phenyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-oxo-4-phenyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate?
The IUPAC name of benzyl 2-oxo-4-phenyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate (CID 13016612) is benzyl 2-oxo-4-phenyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate.
What is the SMILES notation for benzyl 2-oxo-4-phenyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate?
The canonical SMILES for benzyl 2-oxo-4-phenyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate is O=C1NC(c2ccccc2)C2(CCN(C(=O)OCc3ccccc3)CC2)O1.
What is the InChIKey of benzyl 2-oxo-4-phenyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate?
The InChIKey is UOAQXHBWPDSWMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O4/c24-19-22-18(17-9-5-2-6-10-17)21(27-19)11-13-23(14-12-21)20(25)26-15-16-7-3-1-4-8-16/h1-10,18H,11-15H2,(H,22,24).
What are the key properties of benzyl 2-oxo-4-phenyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate?
benzyl 2-oxo-4-phenyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate has a molecular weight of 366.42 g/mol, XLogP of 3.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-oxo-4-phenyl-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate is sourced from PubChem (CID 13016612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).