C16H10N2S2 — CID 13016724
2,3-di(thiophen-3-yl)quinoxaline (PubChem CID 13016724) has the molecular formula C16H10N2S2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2,3-di(thiophen-3-yl)quinoxaline.
| Compound Name | 2,3-di(thiophen-3-yl)quinoxaline |
|---|---|
| PubChem CID | 13016724 |
| Molecular Formula | C16H10N2S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2,3-di(thiophen-3-yl)quinoxaline |
| SMILES | c1ccc2nc(-c3ccsc3)c(-c3ccsc3)nc2c1 |
| InChI | InChI=1S/C16H10N2S2/c1-2-4-14-13(3-1)17-15(11-5-7-19-9-11)16(18-14)12-6-8-20-10-12/h1-10H |
| InChIKey | MFAUGUGMBDSUSW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |