C9H17ClN2O — CID 13017040
2-chloro-N-(2,4-dimethylpentan-3-ylideneamino)acetamide (PubChem CID 13017040) has the molecular formula C9H17ClN2O and a molecular weight of 204.70 g/mol. Its IUPAC name is 2-chloro-N-(2,4-dimethylpentan-3-ylideneamino)acetamide.
| Compound Name | 2-chloro-N-(2,4-dimethylpentan-3-ylideneamino)acetamide |
|---|---|
| PubChem CID | 13017040 |
| Molecular Formula | C9H17ClN2O |
| Molecular Weight | 204.70 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-chloro-N-(2,4-dimethylpentan-3-ylideneamino)acetamide |
| SMILES | CC(C)C(=NNC(=O)CCl)C(C)C |
| InChI | InChI=1S/C9H17ClN2O/c1-6(2)9(7(3)4)12-11-8(13)5-10/h6-7H,5H2,1-4H3,(H,11,13) |
| InChIKey | XPBFFNOUNILEIR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.70 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|