About 2-(4-bromophenyl)-1,4-dihydroimidazol-5-one
2-(4-bromophenyl)-1,4-dihydroimidazol-5-one (PubChem CID 130174174) has the molecular formula C9H7BrN2O
and a molecular weight of 239.07 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1,4-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-1,4-dihydroimidazol-5-one |
| PubChem CID | 130174174 |
| Molecular Formula | C9H7BrN2O |
| Molecular Weight | 239.07 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | 2-(4-bromophenyl)-1,4-dihydroimidazol-5-one |
| SMILES | O=C1CN=C(c2ccc(Br)cc2)N1 |
| InChI | InChI=1S/C9H7BrN2O/c10-7-3-1-6(2-4-7)9-11-5-8(13)12-9/h1-4H,5H2,(H,11,12,13) |
| InChIKey | OGBOLSLXDLRSAC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.07 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-bromophenyl)-1,4-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-1,4-dihydroimidazol-5-one?
The IUPAC name of 2-(4-bromophenyl)-1,4-dihydroimidazol-5-one (CID 130174174) is 2-(4-bromophenyl)-1,4-dihydroimidazol-5-one.
What is the SMILES notation for 2-(4-bromophenyl)-1,4-dihydroimidazol-5-one?
The canonical SMILES for 2-(4-bromophenyl)-1,4-dihydroimidazol-5-one is O=C1CN=C(c2ccc(Br)cc2)N1.
What is the InChIKey of 2-(4-bromophenyl)-1,4-dihydroimidazol-5-one?
The InChIKey is OGBOLSLXDLRSAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrN2O/c10-7-3-1-6(2-4-7)9-11-5-8(13)12-9/h1-4H,5H2,(H,11,12,13).
What are the key properties of 2-(4-bromophenyl)-1,4-dihydroimidazol-5-one?
2-(4-bromophenyl)-1,4-dihydroimidazol-5-one has a molecular weight of 239.07 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-1,4-dihydroimidazol-5-one is sourced from PubChem (CID 130174174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).