About 3-hydroxy-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3-carboxamide
3-hydroxy-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3-carboxamide (PubChem CID 130174434) has the molecular formula C7H10N4O2S
and a molecular weight of 214.25 g/mol. Its IUPAC name is 3-hydroxy-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | 3-hydroxy-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3-carboxamide |
| PubChem CID | 130174434 |
| Molecular Formula | C7H10N4O2S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 3-hydroxy-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1(O)CCN(c2ncns2)C1 |
| InChI | InChI=1S/C7H10N4O2S/c8-5(12)7(13)1-2-11(3-7)6-9-4-10-14-6/h4,13H,1-3H2,(H2,8,12) |
| InChIKey | XZFUWOOYTCAVCA-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-hydroxy-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3-carboxamide?
The IUPAC name of 3-hydroxy-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3-carboxamide (CID 130174434) is 3-hydroxy-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3-carboxamide.
What is the SMILES notation for 3-hydroxy-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3-carboxamide?
The canonical SMILES for 3-hydroxy-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3-carboxamide is NC(=O)C1(O)CCN(c2ncns2)C1.
What is the InChIKey of 3-hydroxy-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3-carboxamide?
The InChIKey is XZFUWOOYTCAVCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2S/c8-5(12)7(13)1-2-11(3-7)6-9-4-10-14-6/h4,13H,1-3H2,(H2,8,12).
What are the key properties of 3-hydroxy-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3-carboxamide?
3-hydroxy-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3-carboxamide has a molecular weight of 214.25 g/mol, XLogP of -1.04, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3-carboxamide is sourced from PubChem (CID 130174434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).