About methyl 3-(3-oxo-1,2-thiazol-2-yl)propanoate;hydrochloride
methyl 3-(3-oxo-1,2-thiazol-2-yl)propanoate;hydrochloride (PubChem CID 13017444) has the molecular formula C7H10ClNO3S
and a molecular weight of 223.68 g/mol. Its IUPAC name is methyl 3-(3-oxo-1,2-thiazol-2-yl)propanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 3-(3-oxo-1,2-thiazol-2-yl)propanoate;hydrochloride |
| PubChem CID | 13017444 |
| Molecular Formula | C7H10ClNO3S |
| Molecular Weight | 223.68 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | methyl 3-(3-oxo-1,2-thiazol-2-yl)propanoate;hydrochloride |
| SMILES | COC(=O)CCn1sccc1=O.Cl |
| InChI | InChI=1S/C7H9NO3S.ClH/c1-11-7(10)2-4-8-6(9)3-5-12-8;/h3,5H,2,4H2,1H3;1H |
| InChIKey | BHPSZGCSRCLTLG-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.68 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-(3-oxo-1,2-thiazol-2-yl)propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3-oxo-1,2-thiazol-2-yl)propanoate;hydrochloride?
The IUPAC name of methyl 3-(3-oxo-1,2-thiazol-2-yl)propanoate;hydrochloride (CID 13017444) is methyl 3-(3-oxo-1,2-thiazol-2-yl)propanoate;hydrochloride.
What is the SMILES notation for methyl 3-(3-oxo-1,2-thiazol-2-yl)propanoate;hydrochloride?
The canonical SMILES for methyl 3-(3-oxo-1,2-thiazol-2-yl)propanoate;hydrochloride is COC(=O)CCn1sccc1=O.Cl.
What is the InChIKey of methyl 3-(3-oxo-1,2-thiazol-2-yl)propanoate;hydrochloride?
The InChIKey is BHPSZGCSRCLTLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3S.ClH/c1-11-7(10)2-4-8-6(9)3-5-12-8;/h3,5H,2,4H2,1H3;1H.
What are the key properties of methyl 3-(3-oxo-1,2-thiazol-2-yl)propanoate;hydrochloride?
methyl 3-(3-oxo-1,2-thiazol-2-yl)propanoate;hydrochloride has a molecular weight of 223.68 g/mol, XLogP of 0.89, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-oxo-1,2-thiazol-2-yl)propanoate;hydrochloride is sourced from PubChem (CID 13017444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).