About (1R,3S)-2-(nitromethylidene)tricyclo[4.2.1.03,9]nonane
(1R,3S)-2-(nitromethylidene)tricyclo[4.2.1.03,9]nonane (PubChem CID 130176307) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is (1R,3S)-2-(nitromethylidene)tricyclo[4.2.1.03,9]nonane.
Molecular Properties
| Compound Name | (1R,3S)-2-(nitromethylidene)tricyclo[4.2.1.03,9]nonane |
| PubChem CID | 130176307 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (1R,3S)-2-(nitromethylidene)tricyclo[4.2.1.03,9]nonane |
| SMILES | O=[N+]([O-])/C=C1/[C@H]2CCC3CC[C@@H]1C32 |
| InChI | InChI=1S/C10H13NO2/c12-11(13)5-9-7-3-1-6-2-4-8(9)10(6)7/h5-8,10H,1-4H2/b9-5-/t6?,7-,8+,10?/m1/s1 |
| InChIKey | VWFDLUSLWXZQEF-NXWMFSQDSA-N |
| XLogP | 2.21 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1R,3S)-2-(nitromethylidene)tricyclo[4.2.1.03,9]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,3S)-2-(nitromethylidene)tricyclo[4.2.1.03,9]nonane?
The IUPAC name of (1R,3S)-2-(nitromethylidene)tricyclo[4.2.1.03,9]nonane (CID 130176307) is (1R,3S)-2-(nitromethylidene)tricyclo[4.2.1.03,9]nonane.
What is the SMILES notation for (1R,3S)-2-(nitromethylidene)tricyclo[4.2.1.03,9]nonane?
The canonical SMILES for (1R,3S)-2-(nitromethylidene)tricyclo[4.2.1.03,9]nonane is O=[N+]([O-])/C=C1/[C@H]2CCC3CC[C@@H]1C32.
What is the InChIKey of (1R,3S)-2-(nitromethylidene)tricyclo[4.2.1.03,9]nonane?
The InChIKey is VWFDLUSLWXZQEF-NXWMFSQDSA-N. The full InChI is InChI=1S/C10H13NO2/c12-11(13)5-9-7-3-1-6-2-4-8(9)10(6)7/h5-8,10H,1-4H2/b9-5-/t6?,7-,8+,10?/m1/s1.
What are the key properties of (1R,3S)-2-(nitromethylidene)tricyclo[4.2.1.03,9]nonane?
(1R,3S)-2-(nitromethylidene)tricyclo[4.2.1.03,9]nonane has a molecular weight of 179.22 g/mol, XLogP of 2.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,3S)-2-(nitromethylidene)tricyclo[4.2.1.03,9]nonane is sourced from PubChem (CID 130176307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).