C35H31F7N8O3 — CID 130176747
N-[4-[4-[4-[6-[2-(2,4-difluorophenyl)-1,1-difluoro-2-hydroxy-3-(tetrazol-1-yl)propyl]-3-pyridinyl]phenyl]piperazin-1-yl]phenyl]-4,4,4-trifluoro-2-hydroxybutanamide (PubChem CID 130176747) has the molecular formula C35H31F7N8O3 and a molecular weight of 744.67 g/mol. Its IUPAC name is N-[4-[4-[4-[6-[2-(2,4-difluorophenyl)-1,1-difluoro-2-hydroxy-3-(tetrazol-1-yl)propyl]-3-pyridinyl]phenyl]piperazin-1-yl]phenyl]-4,4,4-trifluoro-2-hydroxybutanamide.
| Compound Name | N-[4-[4-[4-[6-[2-(2,4-difluorophenyl)-1,1-difluoro-2-hydroxy-3-(tetrazol-1-yl)propyl]-3-pyridinyl]phenyl]piperazin-1-yl]phenyl]-4,4,4-trifluoro-2-hydroxybutanamide |
|---|---|
| PubChem CID | 130176747 |
| Molecular Formula | C35H31F7N8O3 |
| Molecular Weight | 744.67 g/mol |
| Exact Mass | 744.24 |
| IUPAC Name | N-[4-[4-[4-[6-[2-(2,4-difluorophenyl)-1,1-difluoro-2-hydroxy-3-(tetrazol-1-yl)propyl]-3-pyridinyl]phenyl]piperazin-1-yl]phenyl]-4,4,4-trifluoro-2-hydroxybutanamide |
| SMILES | O=C(Nc1ccc(N2CCN(c3ccc(-c4ccc(C(F)(F)C(O)(Cn5cnnn5)c5ccc(F)cc5F)nc4)cc3)CC2)cc1)C(O)CC(F)(F)F |
| InChI | InChI=1S/C35H31F7N8O3/c36-24-4-11-28(29(37)17-24)33(53,20-50-21-44-46-47-50)35(41,42)31-12-3-23(19-43-31)22-1-7-26(8-2-22)48-13-15-49(16-14-48)27-9-5-25(6-10-27)45-32(52)30(51)18-34(38,39)40/h1-12,17,19,21,30,51,53H,13-16,18,20H2,(H,45,52) |
| InChIKey | YWCFXWDEBOCCPE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 132.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.67 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|