About methyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]prop-2-enoate
methyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]prop-2-enoate (PubChem CID 130176980) has the molecular formula C16H10F6N2O2
and a molecular weight of 376.26 g/mol. Its IUPAC name is methyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]prop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]prop-2-enoate |
| PubChem CID | 130176980 |
| Molecular Formula | C16H10F6N2O2 |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | methyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C16H10F6N2O2/c1-26-13(25)3-2-12-4-5-23-14(24-12)9-6-10(15(17,18)19)8-11(7-9)16(20,21)22/h2-8H,1H3/b3-2+ |
| InChIKey | PHWVRGCKBPFXAH-NSCUHMNNSA-N |
| XLogP | 4.37 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]prop-2-enoate?
The IUPAC name of methyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]prop-2-enoate (CID 130176980) is methyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]prop-2-enoate.
What is the SMILES notation for methyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]prop-2-enoate?
The canonical SMILES for methyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]prop-2-enoate is COC(=O)/C=C/c1ccnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1.
What is the InChIKey of methyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]prop-2-enoate?
The InChIKey is PHWVRGCKBPFXAH-NSCUHMNNSA-N. The full InChI is InChI=1S/C16H10F6N2O2/c1-26-13(25)3-2-12-4-5-23-14(24-12)9-6-10(15(17,18)19)8-11(7-9)16(20,21)22/h2-8H,1H3/b3-2+.
What are the key properties of methyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]prop-2-enoate?
methyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]prop-2-enoate has a molecular weight of 376.26 g/mol, XLogP of 4.37, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]prop-2-enoate is sourced from PubChem (CID 130176980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).