C20H14F6N4O2 — CID 130176990
(E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enamide (PubChem CID 130176990) has the molecular formula C20H14F6N4O2 and a molecular weight of 456.35 g/mol. Its IUPAC name is (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enamide.
| Compound Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 130176990 |
| Molecular Formula | C20H14F6N4O2 |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enamide |
| SMILES | Cc1noc(C)c1/C(=C\c1ccnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)C(N)=O |
| InChI | InChI=1S/C20H14F6N4O2/c1-9-16(10(2)32-30-9)15(17(27)31)8-14-3-4-28-18(29-14)11-5-12(19(21,22)23)7-13(6-11)20(24,25)26/h3-8H,1-2H3,(H2,27,31)/b15-8+ |
| InChIKey | INGCBKNLMLSUTN-OVCLIPMQSA-N |
| XLogP | 4.81 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|