About (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoic acid
(Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoic acid (PubChem CID 130176993) has the molecular formula C15H7BrF6N2O2
and a molecular weight of 441.13 g/mol. Its IUPAC name is (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoic acid.
Molecular Properties
| Compound Name | (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoic acid |
| PubChem CID | 130176993 |
| Molecular Formula | C15H7BrF6N2O2 |
| Molecular Weight | 441.13 g/mol |
| Exact Mass | 439.96 |
| IUPAC Name | (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoic acid |
| SMILES | O=C(O)/C(Br)=C/c1ccnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C15H7BrF6N2O2/c16-11(13(25)26)6-10-1-2-23-12(24-10)7-3-8(14(17,18)19)5-9(4-7)15(20,21)22/h1-6H,(H,25,26)/b11-6- |
| InChIKey | NFCAIQUZSKJGHJ-WDZFZDKYSA-N |
| XLogP | 5.00 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.13 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoic acid?
The IUPAC name of (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoic acid (CID 130176993) is (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoic acid.
What is the SMILES notation for (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoic acid?
The canonical SMILES for (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoic acid is O=C(O)/C(Br)=C/c1ccnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1.
What is the InChIKey of (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoic acid?
The InChIKey is NFCAIQUZSKJGHJ-WDZFZDKYSA-N. The full InChI is InChI=1S/C15H7BrF6N2O2/c16-11(13(25)26)6-10-1-2-23-12(24-10)7-3-8(14(17,18)19)5-9(4-7)15(20,21)22/h1-6H,(H,25,26)/b11-6-.
What are the key properties of (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoic acid?
(Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoic acid has a molecular weight of 441.13 g/mol, XLogP of 5.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoic acid is sourced from PubChem (CID 130176993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).