C27H24F6N4O4S — CID 130176996
(E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-(2,2-dimethylmorpholin-4-yl)sulfonylphenyl]prop-2-enamide (PubChem CID 130176996) has the molecular formula C27H24F6N4O4S and a molecular weight of 614.57 g/mol. Its IUPAC name is (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-(2,2-dimethylmorpholin-4-yl)sulfonylphenyl]prop-2-enamide.
| Compound Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-(2,2-dimethylmorpholin-4-yl)sulfonylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 130176996 |
| Molecular Formula | C27H24F6N4O4S |
| Molecular Weight | 614.57 g/mol |
| Exact Mass | 614.14 |
| IUPAC Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-(2,2-dimethylmorpholin-4-yl)sulfonylphenyl]prop-2-enamide |
| SMILES | CC1(C)CN(S(=O)(=O)c2cccc(/C(=C\c3ccnc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)n3)C(N)=O)c2)CCO1 |
| InChI | InChI=1S/C27H24F6N4O4S/c1-25(2)15-37(8-9-41-25)42(39,40)21-5-3-4-16(12-21)22(23(34)38)14-20-6-7-35-24(36-20)17-10-18(26(28,29)30)13-19(11-17)27(31,32)33/h3-7,10-14H,8-9,15H2,1-2H3,(H2,34,38)/b22-14+ |
| InChIKey | WQUYRRWALOUIMP-HYARGMPZSA-N |
| XLogP | 5.01 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|