About (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-bromoprop-2-enamide
(E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-bromoprop-2-enamide (PubChem CID 130177000) has the molecular formula C15H8BrF6N3O
and a molecular weight of 440.14 g/mol. Its IUPAC name is (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-bromoprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-bromoprop-2-enamide |
| PubChem CID | 130177000 |
| Molecular Formula | C15H8BrF6N3O |
| Molecular Weight | 440.14 g/mol |
| Exact Mass | 438.98 |
| IUPAC Name | (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-bromoprop-2-enamide |
| SMILES | NC(=O)/C(Br)=C\c1cncc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C15H8BrF6N3O/c16-11(13(23)26)4-10-5-24-6-12(25-10)7-1-8(14(17,18)19)3-9(2-7)15(20,21)22/h1-6H,(H2,23,26)/b11-4+ |
| InChIKey | FSPMCFRMKFCZEW-NYYWCZLTSA-N |
| XLogP | 4.40 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.14 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-bromoprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-bromoprop-2-enamide?
The IUPAC name of (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-bromoprop-2-enamide (CID 130177000) is (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-bromoprop-2-enamide.
What is the SMILES notation for (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-bromoprop-2-enamide?
The canonical SMILES for (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-bromoprop-2-enamide is NC(=O)/C(Br)=C\c1cncc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1.
What is the InChIKey of (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-bromoprop-2-enamide?
The InChIKey is FSPMCFRMKFCZEW-NYYWCZLTSA-N. The full InChI is InChI=1S/C15H8BrF6N3O/c16-11(13(23)26)4-10-5-24-6-12(25-10)7-1-8(14(17,18)19)3-9(2-7)15(20,21)22/h1-6H,(H2,23,26)/b11-4+.
What are the key properties of (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-bromoprop-2-enamide?
(E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-bromoprop-2-enamide has a molecular weight of 440.14 g/mol, XLogP of 4.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-bromoprop-2-enamide is sourced from PubChem (CID 130177000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).