About (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid
(E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid (PubChem CID 130177001) has the molecular formula C19H10F6N4O2
and a molecular weight of 440.30 g/mol. Its IUPAC name is (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid |
| PubChem CID | 130177001 |
| Molecular Formula | C19H10F6N4O2 |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid |
| SMILES | O=C(O)/C(=C/c1cncc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cncnc1 |
| InChI | InChI=1S/C19H10F6N4O2/c20-18(21,22)12-1-10(2-13(3-12)19(23,24)25)16-8-26-7-14(29-16)4-15(17(30)31)11-5-27-9-28-6-11/h1-9H,(H,30,31)/b15-4+ |
| InChIKey | LVHACNNEWMOKQQ-SYZQJQIISA-N |
| XLogP | 4.60 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid?
The IUPAC name of (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid (CID 130177001) is (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid.
What is the SMILES notation for (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid?
The canonical SMILES for (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid is O=C(O)/C(=C/c1cncc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cncnc1.
What is the InChIKey of (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid?
The InChIKey is LVHACNNEWMOKQQ-SYZQJQIISA-N. The full InChI is InChI=1S/C19H10F6N4O2/c20-18(21,22)12-1-10(2-13(3-12)19(23,24)25)16-8-26-7-14(29-16)4-15(17(30)31)11-5-27-9-28-6-11/h1-9H,(H,30,31)/b15-4+.
What are the key properties of (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid?
(E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid has a molecular weight of 440.30 g/mol, XLogP of 4.60, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[6-[3,5-bis(trifluoromethyl)phenyl]pyrazin-2-yl]-2-pyrimidin-5-ylprop-2-enoic acid is sourced from PubChem (CID 130177001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).