About methyl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate
methyl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate (PubChem CID 130177025) has the molecular formula C16H9BrF6N2O2
and a molecular weight of 455.15 g/mol. Its IUPAC name is methyl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate.
Molecular Properties
| Compound Name | methyl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate |
| PubChem CID | 130177025 |
| Molecular Formula | C16H9BrF6N2O2 |
| Molecular Weight | 455.15 g/mol |
| Exact Mass | 453.98 |
| IUPAC Name | methyl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate |
| SMILES | COC(=O)/C(Br)=C/c1ccnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C16H9BrF6N2O2/c1-27-14(26)12(17)7-11-2-3-24-13(25-11)8-4-9(15(18,19)20)6-10(5-8)16(21,22)23/h2-7H,1H3/b12-7- |
| InChIKey | LGQARXAUJOKNAM-GHXNOFRVSA-N |
| XLogP | 5.09 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.15 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate?
The IUPAC name of methyl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate (CID 130177025) is methyl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate.
What is the SMILES notation for methyl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate?
The canonical SMILES for methyl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate is COC(=O)/C(Br)=C/c1ccnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1.
What is the InChIKey of methyl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate?
The InChIKey is LGQARXAUJOKNAM-GHXNOFRVSA-N. The full InChI is InChI=1S/C16H9BrF6N2O2/c1-27-14(26)12(17)7-11-2-3-24-13(25-11)8-4-9(15(18,19)20)6-10(5-8)16(21,22)23/h2-7H,1H3/b12-7-.
What are the key properties of methyl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate?
methyl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate has a molecular weight of 455.15 g/mol, XLogP of 5.09, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-bromoprop-2-enoate is sourced from PubChem (CID 130177025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).