C27H21F9N4O3S — CID 130177061
(E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-[4-(trifluoromethyl)piperidin-1-yl]sulfonylphenyl]prop-2-enamide (PubChem CID 130177061) has the molecular formula C27H21F9N4O3S and a molecular weight of 652.54 g/mol. Its IUPAC name is (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-[4-(trifluoromethyl)piperidin-1-yl]sulfonylphenyl]prop-2-enamide.
| Compound Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-[4-(trifluoromethyl)piperidin-1-yl]sulfonylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 130177061 |
| Molecular Formula | C27H21F9N4O3S |
| Molecular Weight | 652.54 g/mol |
| Exact Mass | 652.12 |
| IUPAC Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-[4-(trifluoromethyl)piperidin-1-yl]sulfonylphenyl]prop-2-enamide |
| SMILES | NC(=O)/C(=C/c1ccnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cccc(S(=O)(=O)N2CCC(C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C27H21F9N4O3S/c28-25(29,30)17-5-8-40(9-6-17)44(42,43)21-3-1-2-15(12-21)22(23(37)41)14-20-4-7-38-24(39-20)16-10-18(26(31,32)33)13-19(11-16)27(34,35)36/h1-4,7,10-14,17H,5-6,8-9H2,(H2,37,41)/b22-14+ |
| InChIKey | IAQSXDHQRRNTAF-HYARGMPZSA-N |
| XLogP | 6.17 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.54 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|