C20H16Cl2FN3O2 — CID 130177069
2-(3,5-dichlorophenyl)-4-(6-fluoro-3-pyridinyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione (PubChem CID 130177069) has the molecular formula C20H16Cl2FN3O2 and a molecular weight of 420.27 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-4-(6-fluoro-3-pyridinyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione.
| Compound Name | 2-(3,5-dichlorophenyl)-4-(6-fluoro-3-pyridinyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
|---|---|
| PubChem CID | 130177069 |
| Molecular Formula | C20H16Cl2FN3O2 |
| Molecular Weight | 420.27 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-4-(6-fluoro-3-pyridinyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
| SMILES | O=C1C2C(C(=O)N1c1cc(Cl)cc(Cl)c1)C(c1ccc(F)nc1)N1CCCC21 |
| InChI | InChI=1S/C20H16Cl2FN3O2/c21-11-6-12(22)8-13(7-11)26-19(27)16-14-2-1-5-25(14)18(17(16)20(26)28)10-3-4-15(23)24-9-10/h3-4,6-9,14,16-18H,1-2,5H2 |
| InChIKey | RBXLINJFBXNDCD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.27 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|