C26H20F8N4O3S — CID 130177116
(E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[4-(4,4-difluoropiperidin-1-yl)sulfonylphenyl]prop-2-enamide (PubChem CID 130177116) has the molecular formula C26H20F8N4O3S and a molecular weight of 620.52 g/mol. Its IUPAC name is (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[4-(4,4-difluoropiperidin-1-yl)sulfonylphenyl]prop-2-enamide.
| Compound Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[4-(4,4-difluoropiperidin-1-yl)sulfonylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 130177116 |
| Molecular Formula | C26H20F8N4O3S |
| Molecular Weight | 620.52 g/mol |
| Exact Mass | 620.11 |
| IUPAC Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[4-(4,4-difluoropiperidin-1-yl)sulfonylphenyl]prop-2-enamide |
| SMILES | NC(=O)/C(=C/c1ccnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1ccc(S(=O)(=O)N2CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C26H20F8N4O3S/c27-24(28)6-9-38(10-7-24)42(40,41)20-3-1-15(2-4-20)21(22(35)39)14-19-5-8-36-23(37-19)16-11-17(25(29,30)31)13-18(12-16)26(32,33)34/h1-5,8,11-14H,6-7,9-10H2,(H2,35,39)/b21-14+ |
| InChIKey | MANREYWRZUQZIF-KGENOOAVSA-N |
| XLogP | 5.63 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|