C30H40N4 — CID 130177778
1-[1-methyl-2-[C-methyl-N-(2,3,4,5,6-pentamethylphenyl)carbonimidoyl]imidazol-4-yl]-N-(2,3,4,5,6-pentamethylphenyl)ethanimine (PubChem CID 130177778) has the molecular formula C30H40N4 and a molecular weight of 456.68 g/mol. Its IUPAC name is 1-[1-methyl-2-[C-methyl-N-(2,3,4,5,6-pentamethylphenyl)carbonimidoyl]imidazol-4-yl]-N-(2,3,4,5,6-pentamethylphenyl)ethanimine.
| Compound Name | 1-[1-methyl-2-[C-methyl-N-(2,3,4,5,6-pentamethylphenyl)carbonimidoyl]imidazol-4-yl]-N-(2,3,4,5,6-pentamethylphenyl)ethanimine |
|---|---|
| PubChem CID | 130177778 |
| Molecular Formula | C30H40N4 |
| Molecular Weight | 456.68 g/mol |
| Exact Mass | 456.33 |
| IUPAC Name | 1-[1-methyl-2-[C-methyl-N-(2,3,4,5,6-pentamethylphenyl)carbonimidoyl]imidazol-4-yl]-N-(2,3,4,5,6-pentamethylphenyl)ethanimine |
| SMILES | C/C(=N\c1c(C)c(C)c(C)c(C)c1C)c1cn(C)c(/C(C)=N/c2c(C)c(C)c(C)c(C)c2C)n1 |
| InChI | InChI=1S/C30H40N4/c1-15-17(3)21(7)28(22(8)18(15)4)31-25(11)27-14-34(13)30(33-27)26(12)32-29-23(9)19(5)16(2)20(6)24(29)10/h14H,1-13H3/b31-25+,32-26+ |
| InChIKey | QZGGDCIHKRLSBS-YESHOFFLSA-N |
| XLogP | 7.79 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.68 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|