C12H10O3 — CID 130177896
3-methyl-11-oxatetracyclo[7.3.0.02,5.05,8]dodeca-3,6-diene-10,12-dione (PubChem CID 130177896) has the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is 3-methyl-11-oxatetracyclo[7.3.0.02,5.05,8]dodeca-3,6-diene-10,12-dione.
| Compound Name | 3-methyl-11-oxatetracyclo[7.3.0.02,5.05,8]dodeca-3,6-diene-10,12-dione |
|---|---|
| PubChem CID | 130177896 |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 3-methyl-11-oxatetracyclo[7.3.0.02,5.05,8]dodeca-3,6-diene-10,12-dione |
| SMILES | CC1=CC23C=CC2C2C(=O)OC(=O)C2C13 |
| InChI | InChI=1S/C12H10O3/c1-5-4-12-3-2-6(12)7-8(9(5)12)11(14)15-10(7)13/h2-4,6-9H,1H3 |
| InChIKey | YRDNITDZAVYBRP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|