About 4-(dimethylamino)nona-7,8-dien-2-ol
4-(dimethylamino)nona-7,8-dien-2-ol (PubChem CID 130178051) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 4-(dimethylamino)nona-7,8-dien-2-ol.
Molecular Properties
| Compound Name | 4-(dimethylamino)nona-7,8-dien-2-ol |
| PubChem CID | 130178051 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 4-(dimethylamino)nona-7,8-dien-2-ol |
| SMILES | C=C=CCCC(CC(C)O)N(C)C |
| InChI | InChI=1S/C11H21NO/c1-5-6-7-8-11(12(3)4)9-10(2)13/h6,10-11,13H,1,7-9H2,2-4H3 |
| InChIKey | MVEFIOMNNKAOGU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(dimethylamino)nona-7,8-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)nona-7,8-dien-2-ol?
The IUPAC name of 4-(dimethylamino)nona-7,8-dien-2-ol (CID 130178051) is 4-(dimethylamino)nona-7,8-dien-2-ol.
What is the SMILES notation for 4-(dimethylamino)nona-7,8-dien-2-ol?
The canonical SMILES for 4-(dimethylamino)nona-7,8-dien-2-ol is C=C=CCCC(CC(C)O)N(C)C.
What is the InChIKey of 4-(dimethylamino)nona-7,8-dien-2-ol?
The InChIKey is MVEFIOMNNKAOGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-5-6-7-8-11(12(3)4)9-10(2)13/h6,10-11,13H,1,7-9H2,2-4H3.
What are the key properties of 4-(dimethylamino)nona-7,8-dien-2-ol?
4-(dimethylamino)nona-7,8-dien-2-ol has a molecular weight of 183.29 g/mol, XLogP of 1.81, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)nona-7,8-dien-2-ol is sourced from PubChem (CID 130178051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).