C12H10F4N2OS — CID 130178080
2-methylsulfanyl-1-[1-(1,1,2,2-tetrafluoroethyl)pyrrolo[2,3-b]pyridin-3-yl]ethanone (PubChem CID 130178080) has the molecular formula C12H10F4N2OS and a molecular weight of 306.28 g/mol. Its IUPAC name is 2-methylsulfanyl-1-[1-(1,1,2,2-tetrafluoroethyl)pyrrolo[2,3-b]pyridin-3-yl]ethanone.
| Compound Name | 2-methylsulfanyl-1-[1-(1,1,2,2-tetrafluoroethyl)pyrrolo[2,3-b]pyridin-3-yl]ethanone |
|---|---|
| PubChem CID | 130178080 |
| Molecular Formula | C12H10F4N2OS |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 2-methylsulfanyl-1-[1-(1,1,2,2-tetrafluoroethyl)pyrrolo[2,3-b]pyridin-3-yl]ethanone |
| SMILES | CSCC(=O)c1cn(C(F)(F)C(F)F)c2ncccc12 |
| InChI | InChI=1S/C12H10F4N2OS/c1-20-6-9(19)8-5-18(12(15,16)11(13)14)10-7(8)3-2-4-17-10/h2-5,11H,6H2,1H3 |
| InChIKey | UGIOTEHXRWCTPV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|